C23H18F3NO — CID 57219402
3-imino-5-(3-methylnaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one (PubChem CID 57219402) has the molecular formula C23H18F3NO and a molecular weight of 381.40 g/mol. Its IUPAC name is 3-imino-5-(3-methylnaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one.
| Compound Name | 3-imino-5-(3-methylnaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 57219402 |
| Molecular Formula | C23H18F3NO |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-imino-5-(3-methylnaphthalen-1-yl)-2-[3-(trifluoromethyl)phenyl]cyclopentan-1-one |
| SMILES | [H]/N=C1\CC(c2cc(C)cc3ccccc23)C(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F3NO/c1-13-9-14-5-2-3-8-17(14)18(10-13)19-12-20(27)21(22(19)28)15-6-4-7-16(11-15)23(24,25)26/h2-11,19,21,27H,12H2,1H3/b27-20+ |
| InChIKey | WBPYWJVOORHLCI-NHFJDJAPSA-N |
| XLogP | 6.03 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|