C4H10O5 — CID 57220636
1,4-dihydroperoxybutan-2-ol (PubChem CID 57220636) has the molecular formula C4H10O5 and a molecular weight of 138.12 g/mol. Its IUPAC name is 1,4-dihydroperoxybutan-2-ol.
| Compound Name | 1,4-dihydroperoxybutan-2-ol |
|---|---|
| PubChem CID | 57220636 |
| Molecular Formula | C4H10O5 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 1,4-dihydroperoxybutan-2-ol |
| SMILES | OOCCC(O)COO |
| InChI | InChI=1S/C4H10O5/c5-4(3-9-7)1-2-8-6/h4-7H,1-3H2 |
| InChIKey | FITFOJONXJZRKZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|