About (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol
(2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol (PubChem CID 58565866) has the molecular formula C8H18O6
and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol.
Molecular Properties
| Compound Name | (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol |
| PubChem CID | 58565866 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol |
| SMILES | OC[C@H](CCOO)[C@H](CO)CCOO |
| InChI | InChI=1S/C8H18O6/c9-5-7(1-3-13-11)8(6-10)2-4-14-12/h7-12H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | SJKATRMRCPAWOS-YUMQZZPRSA-N |
| XLogP | -0.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol?
The IUPAC name of (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol (CID 58565866) is (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol.
What is the SMILES notation for (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol?
The canonical SMILES for (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol is OC[C@H](CCOO)[C@H](CO)CCOO.
What is the InChIKey of (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol?
The InChIKey is SJKATRMRCPAWOS-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H18O6/c9-5-7(1-3-13-11)8(6-10)2-4-14-12/h7-12H,1-6H2/t7-,8-/m0/s1.
What are the key properties of (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol?
(2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol has a molecular weight of 210.23 g/mol, XLogP of -0.04, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol is sourced from PubChem (CID 58565866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).