C8H18O6 — CID 58565866
(2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol (PubChem CID 58565866) has the molecular formula C8H18O6 and a molecular weight of 210.23 g/mol. Its IUPAC name is (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol.
| Compound Name | (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol |
|---|---|
| PubChem CID | 58565866 |
| Molecular Formula | C8H18O6 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2R,3R)-2,3-bis(2-hydroperoxyethyl)butane-1,4-diol |
| SMILES | OC[C@H](CCOO)[C@H](CO)CCOO |
| InChI | InChI=1S/C8H18O6/c9-5-7(1-3-13-11)8(6-10)2-4-14-12/h7-12H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | SJKATRMRCPAWOS-YUMQZZPRSA-N |
| XLogP | -0.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|