C10H12O5 — CID 57221642
(2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]pent-4-ynoic acid (PubChem CID 57221642) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]pent-4-ynoic acid.
| Compound Name | (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 57221642 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (2R)-2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]pent-4-ynoic acid |
| SMILES | C#CC[C@@H](C(=O)O)[C@@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H12O5/c1-4-5-6(8(11)12)7-9(13)15-10(2,3)14-7/h1,6-7H,5H2,2-3H3,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | BDBVBHUFAFOEFB-RQJHMYQMSA-N |
| XLogP | 0.39 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|