C11H10N2O5 — CID 57222165
2-[3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid (PubChem CID 57222165) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 57222165 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[3-(3-nitrophenyl)-2,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| SMILES | O=C(O)CC1C=C(c2cccc([N+](=O)[O-])c2)NO1 |
| InChI | InChI=1S/C11H10N2O5/c14-11(15)6-9-5-10(12-18-9)7-2-1-3-8(4-7)13(16)17/h1-5,9,12H,6H2,(H,14,15) |
| InChIKey | HYFIDMVKYMJUON-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|