C27H43NO2S — CID 57222560
(3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-(2,4,4-trimethylpentan-2-yl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-1-carboxamide (PubChem CID 57222560) has the molecular formula C27H43NO2S and a molecular weight of 445.71 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-(2,4,4-trimethylpentan-2-yl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-1-carboxamide.
| Compound Name | (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-(2,4,4-trimethylpentan-2-yl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-1-carboxamide |
|---|---|
| PubChem CID | 57222560 |
| Molecular Formula | C27H43NO2S |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-N-(2,4,4-trimethylpentan-2-yl)-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]thiochromene-1-carboxamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C1CC[C@H]2[C@@H]3CCC4SC(=O)C=C[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C27H43NO2S/c1-24(2,3)16-25(4,5)28-23(30)20-10-9-18-17-8-11-21-27(7,15-13-22(29)31-21)19(17)12-14-26(18,20)6/h13,15,17-21H,8-12,14,16H2,1-7H3,(H,28,30)/t17-,18-,19+,20?,21?,26-,27+/m0/s1 |
| InChIKey | MYXVKWGFEIQURK-NMGNMQOWSA-N |
| XLogP | 6.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|