C27H43NO3 — CID 70345672
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-(2-methylheptan-2-yl)-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]chromene-1-carboxamide (PubChem CID 70345672) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-(2-methylheptan-2-yl)-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]chromene-1-carboxamide.
| Compound Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-(2-methylheptan-2-yl)-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]chromene-1-carboxamide |
|---|---|
| PubChem CID | 70345672 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-N-(2-methylheptan-2-yl)-7-oxo-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]chromene-1-carboxamide |
| SMILES | CCCCCC(C)(C)NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4OC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H43NO3/c1-6-7-8-15-25(2,3)28-24(30)21-11-10-19-18-9-12-22-27(5,17-14-23(29)31-22)20(18)13-16-26(19,21)4/h14,17-22H,6-13,15-16H2,1-5H3,(H,28,30)/t18-,19-,20-,21+,22+,26-,27+/m0/s1 |
| InChIKey | UWUKSLIWNKYRPA-YJPJVVPASA-N |
| XLogP | 5.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|