3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride

C10H24ClN3O2S — CID 57223070

IUPAC3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride
SMILESCN(C)S(=O)(=O)[NH+]1CCNC(C(C)(C)C)C1.[Cl-]
InChIInChI=1S/C10H23N3O2S.ClH/c1-10(2,3)9-8-13(7-6-11-9)16(14,15)12(4)5;/h9,11H,6-8H2,1-5H3;1H
InChIKeyWJIAOERYPLZEPM-UHFFFAOYSA-N
MW285.84 g/mol
LogP-4.30
Rot. Bonds2

About 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride

3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride (PubChem CID 57223070) has the molecular formula C10H24ClN3O2S and a molecular weight of 285.84 g/mol. Its IUPAC name is 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride.

Molecular Properties

Compound Name3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride
PubChem CID57223070
Molecular FormulaC10H24ClN3O2S
Molecular Weight285.84 g/mol
Exact Mass285.13
IUPAC Name3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride
SMILESCN(C)S(=O)(=O)[NH+]1CCNC(C(C)(C)C)C1.[Cl-]
InChIInChI=1S/C10H23N3O2S.ClH/c1-10(2,3)9-8-13(7-6-11-9)16(14,15)12(4)5;/h9,11H,6-8H2,1-5H3;1H
InChIKeyWJIAOERYPLZEPM-UHFFFAOYSA-N
XLogP-4.30
TPSA53.85 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.84
LogP ≤ 5-4.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride?
The IUPAC name of 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride (CID 57223070) is 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride.
What is the SMILES notation for 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride?
The canonical SMILES for 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride is CN(C)S(=O)(=O)[NH+]1CCNC(C(C)(C)C)C1.[Cl-].
What is the InChIKey of 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride?
The InChIKey is WJIAOERYPLZEPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3O2S.ClH/c1-10(2,3)9-8-13(7-6-11-9)16(14,15)12(4)5;/h9,11H,6-8H2,1-5H3;1H.
What are the key properties of 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride?
3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride has a molecular weight of 285.84 g/mol, XLogP of -4.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride is sourced from PubChem (CID 57223070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).