C10H24ClN3O2S — CID 57223070
3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride (PubChem CID 57223070) has the molecular formula C10H24ClN3O2S and a molecular weight of 285.84 g/mol. Its IUPAC name is 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride.
| Compound Name | 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride |
|---|---|
| PubChem CID | 57223070 |
| Molecular Formula | C10H24ClN3O2S |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-tert-butyl-N,N-dimethylpiperazin-1-ium-1-sulfonamide chloride |
| SMILES | CN(C)S(=O)(=O)[NH+]1CCNC(C(C)(C)C)C1.[Cl-] |
| InChI | InChI=1S/C10H23N3O2S.ClH/c1-10(2,3)9-8-13(7-6-11-9)16(14,15)12(4)5;/h9,11H,6-8H2,1-5H3;1H |
| InChIKey | WJIAOERYPLZEPM-UHFFFAOYSA-N |
| XLogP | -4.30 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |