C15H19NO5S — CID 57223269
3-[4-[carboxymethyl-(2-methyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid (PubChem CID 57223269) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-[4-[carboxymethyl-(2-methyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[carboxymethyl-(2-methyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 57223269 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 3-[4-[carboxymethyl-(2-methyl-3-sulfanylpropanoyl)amino]phenyl]propanoic acid |
| SMILES | CC(CS)C(=O)N(CC(=O)O)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-10(9-22)15(21)16(8-14(19)20)12-5-2-11(3-6-12)4-7-13(17)18/h2-3,5-6,10,22H,4,7-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | LZIOVLMTPCXNBC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|