C13H18N2O3S — CID 88705272
2-[(N-methylanilino)-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid (PubChem CID 88705272) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[(N-methylanilino)-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid.
| Compound Name | 2-[(N-methylanilino)-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 88705272 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[(N-methylanilino)-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid |
| SMILES | CC(CS)C(=O)N(CC(=O)O)N(C)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-10(9-19)13(18)15(8-12(16)17)14(2)11-6-4-3-5-7-11/h3-7,10,19H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | HVCZUWQEOGURRE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|