C12H16N2OS — CID 82116786
4-amino-N,2-dimethyl-N-phenyl-4-sulfanylidenebutanamide (PubChem CID 82116786) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 4-amino-N,2-dimethyl-N-phenyl-4-sulfanylidenebutanamide.
| Compound Name | 4-amino-N,2-dimethyl-N-phenyl-4-sulfanylidenebutanamide |
|---|---|
| PubChem CID | 82116786 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-amino-N,2-dimethyl-N-phenyl-4-sulfanylidenebutanamide |
| SMILES | CC(CC(N)=S)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C12H16N2OS/c1-9(8-11(13)16)12(15)14(2)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H2,13,16) |
| InChIKey | GRXBJLXUKNQKCJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|