C10H13NOS4 — CID 59650840
N-methyl-N-phenyl-2-sulfanylsulfonodithioylpropanamide (PubChem CID 59650840) has the molecular formula C10H13NOS4 and a molecular weight of 291.49 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-sulfanylsulfonodithioylpropanamide.
| Compound Name | N-methyl-N-phenyl-2-sulfanylsulfonodithioylpropanamide |
|---|---|
| PubChem CID | 59650840 |
| Molecular Formula | C10H13NOS4 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | N-methyl-N-phenyl-2-sulfanylsulfonodithioylpropanamide |
| SMILES | CC(C(=O)N(C)c1ccccc1)S(=S)(=S)S |
| InChI | InChI=1S/C10H13NOS4/c1-8(16(13,14)15)10(12)11(2)9-6-4-3-5-7-9/h3-8H,1-2H3,(H,13,14,15) |
| InChIKey | RYSOELPQZQCOMI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|