C18H18F3NO3S — CID 51946875
(2S)-N-methyl-N-phenyl-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]propanamide (PubChem CID 51946875) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is (2S)-N-methyl-N-phenyl-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]propanamide.
| Compound Name | (2S)-N-methyl-N-phenyl-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 51946875 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (2S)-N-methyl-N-phenyl-2-[[2-(trifluoromethyl)phenyl]methylsulfonyl]propanamide |
| SMILES | C[C@@H](C(=O)N(C)c1ccccc1)S(=O)(=O)Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO3S/c1-13(17(23)22(2)15-9-4-3-5-10-15)26(24,25)12-14-8-6-7-11-16(14)18(19,20)21/h3-11,13H,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZQJKBMOZLBSDLR-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |