C14H15ClFNO4 — CID 57224086
ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylbut-3-enoate (PubChem CID 57224086) has the molecular formula C14H15ClFNO4 and a molecular weight of 315.73 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylbut-3-enoate.
| Compound Name | ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 57224086 |
| Molecular Formula | C14H15ClFNO4 |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(OC(=O)Nc1ccc(Cl)cc1F)C(=O)OCC |
| InChI | InChI=1S/C14H15ClFNO4/c1-4-20-13(18)12(8(2)3)21-14(19)17-11-6-5-9(15)7-10(11)16/h5-7,12H,2,4H2,1,3H3,(H,17,19) |
| InChIKey | RLBFBVUYAMPGLC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|