C15H17ClFNO4 — CID 57319746
ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylpent-3-enoate (PubChem CID 57319746) has the molecular formula C15H17ClFNO4 and a molecular weight of 329.76 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylpent-3-enoate.
| Compound Name | ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylpent-3-enoate |
|---|---|
| PubChem CID | 57319746 |
| Molecular Formula | C15H17ClFNO4 |
| Molecular Weight | 329.76 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | ethyl 2-[(4-chloro-2-fluorophenyl)carbamoyloxy]-3-methylpent-3-enoate |
| SMILES | CC=C(C)C(OC(=O)Nc1ccc(Cl)cc1F)C(=O)OCC |
| InChI | InChI=1S/C15H17ClFNO4/c1-4-9(3)13(14(19)21-5-2)22-15(20)18-12-7-6-10(16)8-11(12)17/h4,6-8,13H,5H2,1-3H3,(H,18,20) |
| InChIKey | YTCNBLCEMWRZLP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|