C57H34F6N4O2 — CID 57224272
2-(3-ethynylphenyl)-5-[1-[2-(3-ethynylphenyl)-1-(4-phenoxyphenyl)benzimidazol-5-yl]-1,2,2,3,3,3-hexafluoropropyl]-1-(4-phenoxyphenyl)benzimidazole (PubChem CID 57224272) has the molecular formula C57H34F6N4O2 and a molecular weight of 920.91 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-5-[1-[2-(3-ethynylphenyl)-1-(4-phenoxyphenyl)benzimidazol-5-yl]-1,2,2,3,3,3-hexafluoropropyl]-1-(4-phenoxyphenyl)benzimidazole.
| Compound Name | 2-(3-ethynylphenyl)-5-[1-[2-(3-ethynylphenyl)-1-(4-phenoxyphenyl)benzimidazol-5-yl]-1,2,2,3,3,3-hexafluoropropyl]-1-(4-phenoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 57224272 |
| Molecular Formula | C57H34F6N4O2 |
| Molecular Weight | 920.91 g/mol |
| Exact Mass | 920.26 |
| IUPAC Name | 2-(3-ethynylphenyl)-5-[1-[2-(3-ethynylphenyl)-1-(4-phenoxyphenyl)benzimidazol-5-yl]-1,2,2,3,3,3-hexafluoropropyl]-1-(4-phenoxyphenyl)benzimidazole |
| SMILES | C#Cc1cccc(-c2nc3cc(C(F)(c4ccc5c(c4)nc(-c4cccc(C#C)c4)n5-c4ccc(Oc5ccccc5)cc4)C(F)(F)C(F)(F)F)ccc3n2-c2ccc(Oc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C57H34F6N4O2/c1-3-37-13-11-15-39(33-37)53-64-49-35-41(21-31-51(49)66(53)43-23-27-47(28-24-43)68-45-17-7-5-8-18-45)55(58,56(59,60)57(61,62)63)42-22-32-52-50(36-42)65-54(40-16-12-14-38(4-2)34-40)67(52)44-25-29-48(30-26-44)69-46-19-9-6-10-20-46/h1-2,5-36H |
| InChIKey | FSUKLBKGGZUINQ-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.91 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|