C23H36N4O4S2 — CID 57227879
N-[2-(3-ethyl-N-[N-[2-(methanesulfonamido)ethyl]-3-propylanilino]anilino)ethyl]methanesulfonamide (PubChem CID 57227879) has the molecular formula C23H36N4O4S2 and a molecular weight of 496.70 g/mol. Its IUPAC name is N-[2-(3-ethyl-N-[N-[2-(methanesulfonamido)ethyl]-3-propylanilino]anilino)ethyl]methanesulfonamide.
| Compound Name | N-[2-(3-ethyl-N-[N-[2-(methanesulfonamido)ethyl]-3-propylanilino]anilino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 57227879 |
| Molecular Formula | C23H36N4O4S2 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | N-[2-(3-ethyl-N-[N-[2-(methanesulfonamido)ethyl]-3-propylanilino]anilino)ethyl]methanesulfonamide |
| SMILES | CCCc1cccc(N(CCNS(C)(=O)=O)N(CCNS(C)(=O)=O)c2cccc(CC)c2)c1 |
| InChI | InChI=1S/C23H36N4O4S2/c1-5-9-21-11-8-13-23(19-21)27(17-15-25-33(4,30)31)26(16-14-24-32(3,28)29)22-12-7-10-20(6-2)18-22/h7-8,10-13,18-19,24-25H,5-6,9,14-17H2,1-4H3 |
| InChIKey | XWDJKOLCVVWPBC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|