C58H64N6O8 — CID 57228264
bis[3-[4-[4-(cyclopropylmethoxy)-1H-indol-3-yl]piperidin-1-yl]-1-(1H-indol-4-yloxy)propyl] oxalate (PubChem CID 57228264) has the molecular formula C58H64N6O8 and a molecular weight of 973.18 g/mol. Its IUPAC name is bis[3-[4-[4-(cyclopropylmethoxy)-1H-indol-3-yl]piperidin-1-yl]-1-(1H-indol-4-yloxy)propyl] oxalate.
| Compound Name | bis[3-[4-[4-(cyclopropylmethoxy)-1H-indol-3-yl]piperidin-1-yl]-1-(1H-indol-4-yloxy)propyl] oxalate |
|---|---|
| PubChem CID | 57228264 |
| Molecular Formula | C58H64N6O8 |
| Molecular Weight | 973.18 g/mol |
| Exact Mass | 972.48 |
| IUPAC Name | bis[3-[4-[4-(cyclopropylmethoxy)-1H-indol-3-yl]piperidin-1-yl]-1-(1H-indol-4-yloxy)propyl] oxalate |
| SMILES | O=C(OC(CCN1CCC(c2c[nH]c3cccc(OCC4CC4)c23)CC1)Oc1cccc2[nH]ccc12)C(=O)OC(CCN1CCC(c2c[nH]c3cccc(OCC4CC4)c23)CC1)Oc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C58H64N6O8/c65-57(71-53(69-49-9-1-5-45-41(49)17-25-59-45)23-31-63-27-19-39(20-28-63)43-33-61-47-7-3-11-51(55(43)47)67-35-37-13-14-37)58(66)72-54(70-50-10-2-6-46-42(50)18-26-60-46)24-32-64-29-21-40(22-30-64)44-34-62-48-8-4-12-52(56(44)48)68-36-38-15-16-38/h1-12,17-18,25-26,33-34,37-40,53-54,59-62H,13-16,19-24,27-32,35-36H2 |
| InChIKey | WQZQUZUBPDKWAV-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 159.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.18 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|