C37H36N2O4 — CID 57229139
1-[(3aS,4S,5S,7aS)-4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethanone (PubChem CID 57229139) has the molecular formula C37H36N2O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1-[(3aS,4S,5S,7aS)-4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethanone.
| Compound Name | 1-[(3aS,4S,5S,7aS)-4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 57229139 |
| Molecular Formula | C37H36N2O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 1-[(3aS,4S,5S,7aS)-4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(1H-indol-3-yl)ethanone |
| SMILES | COc1ccccc1[C@@]1(O)[C@@H]2CN(C(=O)Cc3c[nH]c4ccccc34)C[C@@H]2C(c2ccccc2)(c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C37H36N2O4/c1-43-33-19-11-9-17-29(33)37(42)31-24-39(35(41)20-25-22-38-32-18-10-8-16-28(25)32)23-30(31)36(21-34(37)40,26-12-4-2-5-13-26)27-14-6-3-7-15-27/h2-19,22,30-31,34,38,40,42H,20-21,23-24H2,1H3/t30-,31+,34-,37+/m0/s1 |
| InChIKey | VLTGFOMVZRAWFZ-RWAOUDLUSA-N |
| XLogP | 5.43 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |