C36H37NO4 — CID 67804680
1-[(7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 67804680) has the molecular formula C36H37NO4 and a molecular weight of 547.70 g/mol. Its IUPAC name is 1-[(7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[(7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 67804680 |
| Molecular Formula | C36H37NO4 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 1-[(7aS)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)N2CC3[C@H](C2)C(c2ccccc2)(c2ccccc2)CCC3(O)c2ccccc2OC)c1 |
| InChI | InChI=1S/C36H37NO4/c1-40-29-17-11-12-26(22-29)23-34(38)37-24-31-32(25-37)36(39,30-18-9-10-19-33(30)41-2)21-20-35(31,27-13-5-3-6-14-27)28-15-7-4-8-16-28/h3-19,22,31-32,39H,20-21,23-25H2,1-2H3/t31-,32?,36?/m0/s1 |
| InChIKey | ZRCLJXSPAJPBGO-AQYZJEGOSA-N |
| XLogP | 5.99 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |