C36H37NO3 — CID 167031599
(Z)-1-[(4S)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-[(Z)-prop-1-enyl]hex-3-en-5-yn-1-one (PubChem CID 167031599) has the molecular formula C36H37NO3 and a molecular weight of 531.70 g/mol. Its IUPAC name is (Z)-1-[(4S)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-[(Z)-prop-1-enyl]hex-3-en-5-yn-1-one.
| Compound Name | (Z)-1-[(4S)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-[(Z)-prop-1-enyl]hex-3-en-5-yn-1-one |
|---|---|
| PubChem CID | 167031599 |
| Molecular Formula | C36H37NO3 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (Z)-1-[(4S)-4-hydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-[(Z)-prop-1-enyl]hex-3-en-5-yn-1-one |
| SMILES | C#C/C=C(\C=C/C)CC(=O)N1CC2C(C1)[C@](O)(c1ccccc1OC)CCC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37NO3/c1-4-14-27(15-5-2)24-34(38)37-25-31-32(26-37)36(39,30-20-12-13-21-33(30)40-3)23-22-35(31,28-16-8-6-9-17-28)29-18-10-7-11-19-29/h1,5-21,31-32,39H,22-26H2,2-3H3/b15-5-,27-14+/t31?,32?,36-/m1/s1 |
| InChIKey | YSFNEPSYGGEFJG-NLCDNCFLSA-N |
| XLogP | 6.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|