C32H36FNO3 — CID 57167112
tert-butyl (3aS,4S,7aS)-4-fluoro-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindole-2-carboxylate (PubChem CID 57167112) has the molecular formula C32H36FNO3 and a molecular weight of 501.64 g/mol. Its IUPAC name is tert-butyl (3aS,4S,7aS)-4-fluoro-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,4S,7aS)-4-fluoro-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 57167112 |
| Molecular Formula | C32H36FNO3 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | tert-butyl (3aS,4S,7aS)-4-fluoro-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindole-2-carboxylate |
| SMILES | COc1ccccc1[C@]1(F)CCC(c2ccccc2)(c2ccccc2)[C@H]2CN(C(=O)OC(C)(C)C)C[C@H]21 |
| InChI | InChI=1S/C32H36FNO3/c1-30(2,3)37-29(35)34-21-26-27(22-34)32(33,25-17-11-12-18-28(25)36-4)20-19-31(26,23-13-7-5-8-14-23)24-15-9-6-10-16-24/h5-18,26-27H,19-22H2,1-4H3/t26-,27+,32+/m0/s1 |
| InChIKey | DJPHMDFRLSRANE-PYYUSEHKSA-N |
| XLogP | 7.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |