C18H21FN2O2 — CID 171410259
tert-butyl 7-(2-fluorophenyl)-7-isocyano-3-azabicyclo[4.1.0]heptane-3-carboxylate (PubChem CID 171410259) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is tert-butyl 7-(2-fluorophenyl)-7-isocyano-3-azabicyclo[4.1.0]heptane-3-carboxylate.
| Compound Name | tert-butyl 7-(2-fluorophenyl)-7-isocyano-3-azabicyclo[4.1.0]heptane-3-carboxylate |
|---|---|
| PubChem CID | 171410259 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl 7-(2-fluorophenyl)-7-isocyano-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| SMILES | [C-]#[N+]C1(c2ccccc2F)C2CCN(C(=O)OC(C)(C)C)CC21 |
| InChI | InChI=1S/C18H21FN2O2/c1-17(2,3)23-16(22)21-10-9-12-14(11-21)18(12,20-4)13-7-5-6-8-15(13)19/h5-8,12,14H,9-11H2,1-3H3 |
| InChIKey | KAUGWHHZULWZQC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 33.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|