C30H31NO3 — CID 22843241
(3aR,7aR)-2-[(2R)-2-(2-methoxyphenyl)propanoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 22843241) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2R)-2-(2-methoxyphenyl)propanoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | (3aR,7aR)-2-[(2R)-2-(2-methoxyphenyl)propanoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 22843241 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (3aR,7aR)-2-[(2R)-2-(2-methoxyphenyl)propanoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | COc1ccccc1[C@@H](C)C(=O)N1C[C@@H]2C(=O)CCC(c3ccccc3)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C30H31NO3/c1-21(24-15-9-10-16-28(24)34-2)29(33)31-19-25-26(20-31)30(18-17-27(25)32,22-11-5-3-6-12-22)23-13-7-4-8-14-23/h3-16,21,25-26H,17-20H2,1-2H3/t21-,25+,26-/m1/s1 |
| InChIKey | NATHOZZSXBVIQY-QGUKFAFCSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |