C34H34N2O2S — CID 22843226
(3aR,7aR)-2-[C-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbonimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 22843226) has the molecular formula C34H34N2O2S and a molecular weight of 534.73 g/mol. Its IUPAC name is (3aR,7aR)-2-[C-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbonimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | (3aR,7aR)-2-[C-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbonimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 22843226 |
| Molecular Formula | C34H34N2O2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (3aR,7aR)-2-[C-[(2-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbonimidoyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | COc1ccccc1C/C(=N/Cc1cccs1)N1C[C@@H]2C(=O)CCC(c3ccccc3)(c3ccccc3)[C@@H]2C1 |
| InChI | InChI=1S/C34H34N2O2S/c1-38-32-17-9-8-11-25(32)21-33(35-22-28-16-10-20-39-28)36-23-29-30(24-36)34(19-18-31(29)37,26-12-4-2-5-13-26)27-14-6-3-7-15-27/h2-17,20,29-30H,18-19,21-24H2,1H3/b35-33-/t29-,30+/m0/s1 |
| InChIKey | VWVZTULIUMJMNM-GOMSKJHHSA-N |
| XLogP | 6.80 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|