C28H25Cl2NO2 — CID 67916021
2-[2-(2,6-dichlorophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 67916021) has the molecular formula C28H25Cl2NO2 and a molecular weight of 478.42 g/mol. Its IUPAC name is 2-[2-(2,6-dichlorophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | 2-[2-(2,6-dichlorophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 67916021 |
| Molecular Formula | C28H25Cl2NO2 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[2-(2,6-dichlorophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | O=C1CCC(c2ccccc2)(c2ccccc2)C2CN(C(=O)Cc3c(Cl)cccc3Cl)CC12 |
| InChI | InChI=1S/C28H25Cl2NO2/c29-24-12-7-13-25(30)21(24)16-27(33)31-17-22-23(18-31)28(15-14-26(22)32,19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13,22-23H,14-18H2 |
| InChIKey | RHVKLPSSSDQKMH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |