C31H32N2O3 — CID 67916083
methyl 2-[[1-(7-oxo-4,4-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl)-2-phenylethylidene]amino]acetate (PubChem CID 67916083) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is methyl 2-[[1-(7-oxo-4,4-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl)-2-phenylethylidene]amino]acetate.
| Compound Name | methyl 2-[[1-(7-oxo-4,4-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl)-2-phenylethylidene]amino]acetate |
|---|---|
| PubChem CID | 67916083 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 2-[[1-(7-oxo-4,4-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl)-2-phenylethylidene]amino]acetate |
| SMILES | COC(=O)C/N=C(/Cc1ccccc1)N1CC2C(=O)CCC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C31H32N2O3/c1-36-30(35)20-32-29(19-23-11-5-2-6-12-23)33-21-26-27(22-33)31(18-17-28(26)34,24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,26-27H,17-22H2,1H3/b32-29- |
| InChIKey | BQDCWHCTTQGKJD-OVXWJCGASA-N |
| XLogP | 4.70 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|