C31H33NO3 — CID 67916054
7,7-diphenyl-2-[2-(2-propan-2-yloxyphenyl)acetyl]-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 67916054) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 7,7-diphenyl-2-[2-(2-propan-2-yloxyphenyl)acetyl]-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | 7,7-diphenyl-2-[2-(2-propan-2-yloxyphenyl)acetyl]-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 67916054 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 7,7-diphenyl-2-[2-(2-propan-2-yloxyphenyl)acetyl]-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | CC(C)Oc1ccccc1CC(=O)N1CC2C(=O)CCC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C31H33NO3/c1-22(2)35-29-16-10-9-11-23(29)19-30(34)32-20-26-27(21-32)31(18-17-28(26)33,24-12-5-3-6-13-24)25-14-7-4-8-15-25/h3-16,22,26-27H,17-21H2,1-2H3 |
| InChIKey | WWOPCMCVQVQZIM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |