C28H28N2O2 — CID 67915941
2-[2-(2-aminophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 67915941) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[2-(2-aminophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | 2-[2-(2-aminophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 67915941 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[2-(2-aminophenyl)acetyl]-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | Nc1ccccc1CC(=O)N1CC2C(=O)CCC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C28H28N2O2/c29-25-14-8-7-9-20(25)17-27(32)30-18-23-24(19-30)28(16-15-26(23)31,21-10-3-1-4-11-21)22-12-5-2-6-13-22/h1-14,23-24H,15-19,29H2 |
| InChIKey | DEAFZVLRGRZCMH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|