C29H30N2O — CID 67915795
2-(C-benzyl-N-methylcarbonimidoyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one (PubChem CID 67915795) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-(C-benzyl-N-methylcarbonimidoyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one.
| Compound Name | 2-(C-benzyl-N-methylcarbonimidoyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
|---|---|
| PubChem CID | 67915795 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-(C-benzyl-N-methylcarbonimidoyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-4-one |
| SMILES | C/N=C(/Cc1ccccc1)N1CC2C(=O)CCC(c3ccccc3)(c3ccccc3)C2C1 |
| InChI | InChI=1S/C29H30N2O/c1-30-28(19-22-11-5-2-6-12-22)31-20-25-26(21-31)29(18-17-27(25)32,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,25-26H,17-21H2,1H3/b30-28- |
| InChIKey | LVWYQGDKALRHGA-HYOGKJQXSA-N |
| XLogP | 5.15 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|