C27H36N2O3 — CID 22872288
(2S)-1-[(3aR,5R,7S,7aS)-7-hydroxy-7-(2-methoxyphenyl)-5-methyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[2-(dimethylamino)phenyl]propan-1-one (PubChem CID 22872288) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2S)-1-[(3aR,5R,7S,7aS)-7-hydroxy-7-(2-methoxyphenyl)-5-methyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[2-(dimethylamino)phenyl]propan-1-one.
| Compound Name | (2S)-1-[(3aR,5R,7S,7aS)-7-hydroxy-7-(2-methoxyphenyl)-5-methyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[2-(dimethylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 22872288 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | (2S)-1-[(3aR,5R,7S,7aS)-7-hydroxy-7-(2-methoxyphenyl)-5-methyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[2-(dimethylamino)phenyl]propan-1-one |
| SMILES | COc1ccccc1[C@]1(O)C[C@H](C)C[C@H]2CN(C(=O)[C@@H](C)c3ccccc3N(C)C)C[C@H]21 |
| InChI | InChI=1S/C27H36N2O3/c1-18-14-20-16-29(26(30)19(2)21-10-6-8-12-24(21)28(3)4)17-23(20)27(31,15-18)22-11-7-9-13-25(22)32-5/h6-13,18-20,23,31H,14-17H2,1-5H3/t18-,19+,20+,23-,27-/m1/s1 |
| InChIKey | CELBTCNXLCMISL-IVOIZHHCSA-N |
| XLogP | 4.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |