C25H30N4O4 — CID 86752422
1-[5-(azidomethyl)-7-hydroxy-7-(2-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 86752422) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-[5-(azidomethyl)-7-hydroxy-7-(2-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-[5-(azidomethyl)-7-hydroxy-7-(2-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 86752422 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 1-[5-(azidomethyl)-7-hydroxy-7-(2-methoxyphenyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)N1CC2CC(CN=[N+]=[N-])CC(O)(c3ccccc3OC)C2C1 |
| InChI | InChI=1S/C25H30N4O4/c1-32-22-9-5-3-7-18(22)12-24(30)29-15-19-11-17(14-27-28-26)13-25(31,21(19)16-29)20-8-4-6-10-23(20)33-2/h3-10,17,19,21,31H,11-16H2,1-2H3 |
| InChIKey | DYXIBQWZQSXEIM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|