C24H28FNO4 — CID 67660448
1-[7-(2-fluorophenyl)-7-hydroxy-5-(hydroxymethyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone (PubChem CID 67660448) has the molecular formula C24H28FNO4 and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[7-(2-fluorophenyl)-7-hydroxy-5-(hydroxymethyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone.
| Compound Name | 1-[7-(2-fluorophenyl)-7-hydroxy-5-(hydroxymethyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 67660448 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[7-(2-fluorophenyl)-7-hydroxy-5-(hydroxymethyl)-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-(2-methoxyphenyl)ethanone |
| SMILES | COc1ccccc1CC(=O)N1CC2CC(CO)CC(O)(c3ccccc3F)C2C1 |
| InChI | InChI=1S/C24H28FNO4/c1-30-22-9-5-2-6-17(22)11-23(28)26-13-18-10-16(15-27)12-24(29,20(18)14-26)19-7-3-4-8-21(19)25/h2-9,16,18,20,27,29H,10-15H2,1H3 |
| InChIKey | CCQJYLZEMLVXJQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |