C37H39NO5 — CID 18994370
1-[4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(2-methoxyphenyl)propan-1-one (PubChem CID 18994370) has the molecular formula C37H39NO5 and a molecular weight of 577.72 g/mol. Its IUPAC name is 1-[4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(2-methoxyphenyl)propan-1-one.
| Compound Name | 1-[4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(2-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 18994370 |
| Molecular Formula | C37H39NO5 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | 1-[4,5-dihydroxy-4-(2-methoxyphenyl)-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-2-(2-methoxyphenyl)propan-1-one |
| SMILES | COc1ccccc1C(C)C(=O)N1CC2C(C1)C(O)(c1ccccc1OC)C(O)CC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H39NO5/c1-25(28-18-10-12-20-32(28)42-2)35(40)38-23-30-31(24-38)37(41,29-19-11-13-21-33(29)43-3)34(39)22-36(30,26-14-6-4-7-15-26)27-16-8-5-9-17-27/h4-21,25,30-31,34,39,41H,22-24H2,1-3H3 |
| InChIKey | AFIDVTGXGRXLIH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |