C42H51N2O5+ — CID 15379427
[3-[(3aR,4R,5R,7aR)-4-(2,5-dimethoxyphenyl)-4,5-dihydroxy-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-oxopropyl]-benzyl-diethylazanium (PubChem CID 15379427) has the molecular formula C42H51N2O5+ and a molecular weight of 663.88 g/mol. Its IUPAC name is [3-[(3aR,4R,5R,7aR)-4-(2,5-dimethoxyphenyl)-4,5-dihydroxy-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-oxopropyl]-benzyl-diethylazanium.
| Compound Name | [3-[(3aR,4R,5R,7aR)-4-(2,5-dimethoxyphenyl)-4,5-dihydroxy-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-oxopropyl]-benzyl-diethylazanium |
|---|---|
| PubChem CID | 15379427 |
| Molecular Formula | C42H51N2O5+ |
| Molecular Weight | 663.88 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | [3-[(3aR,4R,5R,7aR)-4-(2,5-dimethoxyphenyl)-4,5-dihydroxy-7,7-diphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]-3-oxopropyl]-benzyl-diethylazanium |
| SMILES | CC[N+](CC)(CCC(=O)N1C[C@@H]2[C@H](C1)[C@@](O)(c1cc(OC)ccc1OC)[C@H](O)CC2(c1ccccc1)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H51N2O5/c1-5-44(6-2,30-31-16-10-7-11-17-31)25-24-40(46)43-28-36-37(29-43)42(47,35-26-34(48-3)22-23-38(35)49-4)39(45)27-41(36,32-18-12-8-13-19-32)33-20-14-9-15-21-33/h7-23,26,36-37,39,45,47H,5-6,24-25,27-30H2,1-4H3/q+1/t36-,37+,39-,42+/m1/s1 |
| InChIKey | RYRWQUVUZOYORQ-HDNPWWLTSA-N |
| XLogP | 6.16 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.88 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|