C35H35NO3 — CID 150879451
1-[(3aS,4S,7aS)-4-hydroxy-1-(2-methoxyphenyl)-4,7,7-triphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]ethanone (PubChem CID 150879451) has the molecular formula C35H35NO3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 1-[(3aS,4S,7aS)-4-hydroxy-1-(2-methoxyphenyl)-4,7,7-triphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]ethanone.
| Compound Name | 1-[(3aS,4S,7aS)-4-hydroxy-1-(2-methoxyphenyl)-4,7,7-triphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]ethanone |
|---|---|
| PubChem CID | 150879451 |
| Molecular Formula | C35H35NO3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 1-[(3aS,4S,7aS)-4-hydroxy-1-(2-methoxyphenyl)-4,7,7-triphenyl-1,3,3a,5,6,7a-hexahydroisoindol-2-yl]ethanone |
| SMILES | COc1ccccc1C1[C@H]2[C@@H](CN1C(C)=O)[C@](O)(c1ccccc1)CCC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H35NO3/c1-25(37)36-24-30-32(33(36)29-20-12-13-21-31(29)39-2)34(26-14-6-3-7-15-26,27-16-8-4-9-17-27)22-23-35(30,38)28-18-10-5-11-19-28/h3-21,30,32-33,38H,22-24H2,1-2H3/t30-,32-,33?,35-/m1/s1 |
| InChIKey | KVRYLKDIJBQSNA-RQVXSCPOSA-N |
| XLogP | 6.50 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |