C27H29NO2 — CID 162011049
(3aS,4S,7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-1,2,3,3a,4,5,6,7a-octahydroisoindol-1-ol (PubChem CID 162011049) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is (3aS,4S,7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-1,2,3,3a,4,5,6,7a-octahydroisoindol-1-ol.
| Compound Name | (3aS,4S,7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-1,2,3,3a,4,5,6,7a-octahydroisoindol-1-ol |
|---|---|
| PubChem CID | 162011049 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (3aS,4S,7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-1,2,3,3a,4,5,6,7a-octahydroisoindol-1-ol |
| SMILES | COc1ccccc1[C@H]1CCC(c2ccccc2)(c2ccccc2)[C@H]2C(O)NC[C@@H]12 |
| InChI | InChI=1S/C27H29NO2/c1-30-24-15-9-8-14-22(24)21-16-17-27(19-10-4-2-5-11-19,20-12-6-3-7-13-20)25-23(21)18-28-26(25)29/h2-15,21,23,25-26,28-29H,16-18H2,1H3/t21-,23+,25-,26?/m1/s1 |
| InChIKey | YTLZPWMCCCBCKT-LKKBWZENSA-N |
| XLogP | 4.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |