C27H30ClNO2 — CID 67803841
(7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol;hydrochloride (PubChem CID 67803841) has the molecular formula C27H30ClNO2 and a molecular weight of 436.00 g/mol. Its IUPAC name is (7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol;hydrochloride.
| Compound Name | (7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol;hydrochloride |
|---|---|
| PubChem CID | 67803841 |
| Molecular Formula | C27H30ClNO2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (7aS)-4-(2-methoxyphenyl)-7,7-diphenyl-2,3,3a,5,6,7a-hexahydro-1H-isoindol-4-ol;hydrochloride |
| SMILES | COc1ccccc1C1(O)CCC(c2ccccc2)(c2ccccc2)[C@H]2CNCC21.Cl |
| InChI | InChI=1S/C27H29NO2.ClH/c1-30-25-15-9-8-14-22(25)27(29)17-16-26(20-10-4-2-5-11-20,21-12-6-3-7-13-21)23-18-28-19-24(23)27;/h2-15,23-24,28-29H,16-19H2,1H3;1H/t23-,24?,27?;/m0./s1 |
| InChIKey | LFDLEAOOBNTQGK-DIOINMLFSA-N |
| XLogP | 4.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |