C15H21NO3 — CID 67714228
4-(2-methoxyphenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindole-4,5-diol (PubChem CID 67714228) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindole-4,5-diol.
| Compound Name | 4-(2-methoxyphenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindole-4,5-diol |
|---|---|
| PubChem CID | 67714228 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-(2-methoxyphenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindole-4,5-diol |
| SMILES | COc1ccccc1C1(O)C(O)CCC2CNCC21 |
| InChI | InChI=1S/C15H21NO3/c1-19-13-5-3-2-4-11(13)15(18)12-9-16-8-10(12)6-7-14(15)17/h2-5,10,12,14,16-18H,6-9H2,1H3 |
| InChIKey | OFBSSURWCKABNO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |