C27H44O3 — CID 57229303
(4R)-4-[(3R,10S,13R,17R)-10,13-dimethyl-3-prop-1-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 57229303) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (4R)-4-[(3R,10S,13R,17R)-10,13-dimethyl-3-prop-1-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,10S,13R,17R)-10,13-dimethyl-3-prop-1-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 57229303 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (4R)-4-[(3R,10S,13R,17R)-10,13-dimethyl-3-prop-1-enoxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC=CO[C@@H]1CC[C@@]2(C)C(CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCC(=O)O)C1 |
| InChI | InChI=1S/C27H44O3/c1-5-16-30-20-12-14-26(3)19(17-20)7-8-21-23-10-9-22(18(2)6-11-25(28)29)27(23,4)15-13-24(21)26/h5,16,18-24H,6-15,17H2,1-4H3,(H,28,29)/t18-,19?,20-,21?,22-,23?,24?,26+,27-/m1/s1 |
| InChIKey | IQXYMQPRZPIFTC-BJSLBWNASA-N |
| XLogP | 7.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|