C10H24N2O7P+ — CID 57230640
bis[(3-amino-1,5-dihydroxypentan-3-yl)oxy]-oxophosphanium (PubChem CID 57230640) has the molecular formula C10H24N2O7P+ and a molecular weight of 315.28 g/mol. Its IUPAC name is bis[(3-amino-1,5-dihydroxypentan-3-yl)oxy]-oxophosphanium.
| Compound Name | bis[(3-amino-1,5-dihydroxypentan-3-yl)oxy]-oxophosphanium |
|---|---|
| PubChem CID | 57230640 |
| Molecular Formula | C10H24N2O7P+ |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | bis[(3-amino-1,5-dihydroxypentan-3-yl)oxy]-oxophosphanium |
| SMILES | NC(CCO)(CCO)O[P+](=O)OC(N)(CCO)CCO |
| InChI | InChI=1S/C10H24N2O7P/c11-9(1-5-13,2-6-14)18-20(17)19-10(12,3-7-15)4-8-16/h13-16H,1-8,11-12H2/q+1 |
| InChIKey | VNOWWTKAHDCUMQ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|