C21H25NO4 — CID 57232180
2-(cyclohexylamino)oxy-2-hydroxy-1-[4-(3-methoxyphenyl)phenyl]ethanone (PubChem CID 57232180) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-(cyclohexylamino)oxy-2-hydroxy-1-[4-(3-methoxyphenyl)phenyl]ethanone.
| Compound Name | 2-(cyclohexylamino)oxy-2-hydroxy-1-[4-(3-methoxyphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 57232180 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(cyclohexylamino)oxy-2-hydroxy-1-[4-(3-methoxyphenyl)phenyl]ethanone |
| SMILES | COc1cccc(-c2ccc(C(=O)C(O)ONC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C21H25NO4/c1-25-19-9-5-6-17(14-19)15-10-12-16(13-11-15)20(23)21(24)26-22-18-7-3-2-4-8-18/h5-6,9-14,18,21-22,24H,2-4,7-8H2,1H3 |
| InChIKey | GNSDWKJJBHRXHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|