C15H27N3 — CID 57232949
N-ethyl-2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethanamine (PubChem CID 57232949) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-ethyl-2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethanamine.
| Compound Name | N-ethyl-2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 57232949 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-ethyl-2-[1-(2-ethylpyrrol-2-yl)piperidin-4-yl]ethanamine |
| SMILES | CCNCCC1CCN(C2(CC)C=CC=N2)CC1 |
| InChI | InChI=1S/C15H27N3/c1-3-15(9-5-10-17-15)18-12-7-14(8-13-18)6-11-16-4-2/h5,9-10,14,16H,3-4,6-8,11-13H2,1-2H3 |
| InChIKey | OLXFVGMDWQHANF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|