C23H24FNO2 — CID 57236429
1-(4-fluorophenyl)-N-methoxy-3-(2-naphthalen-2-ylethoxy)but-1-en-1-amine (PubChem CID 57236429) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methoxy-3-(2-naphthalen-2-ylethoxy)but-1-en-1-amine.
| Compound Name | 1-(4-fluorophenyl)-N-methoxy-3-(2-naphthalen-2-ylethoxy)but-1-en-1-amine |
|---|---|
| PubChem CID | 57236429 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methoxy-3-(2-naphthalen-2-ylethoxy)but-1-en-1-amine |
| SMILES | CONC(=CC(C)OCCc1ccc2ccccc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FNO2/c1-17(15-23(25-26-2)20-9-11-22(24)12-10-20)27-14-13-18-7-8-19-5-3-4-6-21(19)16-18/h3-12,15-17,25H,13-14H2,1-2H3 |
| InChIKey | GARLHQNORDTNKU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|