C20H17NO — CID 91604655
5-benzyl-3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole (PubChem CID 91604655) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-benzyl-3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole.
| Compound Name | 5-benzyl-3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 91604655 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 5-benzyl-3-naphthalen-1-yl-2,5-dihydro-1,2-oxazole |
| SMILES | C1=C(c2cccc3ccccc23)NOC1Cc1ccccc1 |
| InChI | InChI=1S/C20H17NO/c1-2-7-15(8-3-1)13-17-14-20(21-22-17)19-12-6-10-16-9-4-5-11-18(16)19/h1-12,14,17,21H,13H2 |
| InChIKey | BVHBZKXBQPCXNG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |