C27H29NO — CID 54042432
1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]-1-(4-propan-2-ylphenyl)methanamine (PubChem CID 54042432) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]-1-(4-propan-2-ylphenyl)methanamine.
| Compound Name | 1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]-1-(4-propan-2-ylphenyl)methanamine |
|---|---|
| PubChem CID | 54042432 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 1-cyclopropylidene-N-[(2-methyl-3-phenylphenyl)methoxy]-1-(4-propan-2-ylphenyl)methanamine |
| SMILES | Cc1c(CONC(=C2CC2)c2ccc(C(C)C)cc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C27H29NO/c1-19(2)21-12-14-23(15-13-21)27(24-16-17-24)28-29-18-25-10-7-11-26(20(25)3)22-8-5-4-6-9-22/h4-15,19,28H,16-18H2,1-3H3 |
| InChIKey | LNGYZNKJZKRXDL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|