C23H20F3NO2 — CID 90981218
[4-[1-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]methanol (PubChem CID 90981218) has the molecular formula C23H20F3NO2 and a molecular weight of 399.41 g/mol. Its IUPAC name is [4-[1-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]methanol.
| Compound Name | [4-[1-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 90981218 |
| Molecular Formula | C23H20F3NO2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [4-[1-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxyamino]ethenyl]phenyl]methanol |
| SMILES | C=C(NOCc1ccc(-c2ccccc2)c(C(F)(F)F)c1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C23H20F3NO2/c1-16(19-10-7-17(14-28)8-11-19)27-29-15-18-9-12-21(20-5-3-2-4-6-20)22(13-18)23(24,25)26/h2-13,27-28H,1,14-15H2 |
| InChIKey | ORWBQMALQNZLSP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|