C22H20FNO2 — CID 91085130
[2-benzyl-6-[(4-fluorophenyl)methyl]-3-(nitrosomethyl)phenyl]methanol (PubChem CID 91085130) has the molecular formula C22H20FNO2 and a molecular weight of 349.41 g/mol. Its IUPAC name is [2-benzyl-6-[(4-fluorophenyl)methyl]-3-(nitrosomethyl)phenyl]methanol.
| Compound Name | [2-benzyl-6-[(4-fluorophenyl)methyl]-3-(nitrosomethyl)phenyl]methanol |
|---|---|
| PubChem CID | 91085130 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [2-benzyl-6-[(4-fluorophenyl)methyl]-3-(nitrosomethyl)phenyl]methanol |
| SMILES | O=NCc1ccc(Cc2ccc(F)cc2)c(CO)c1Cc1ccccc1 |
| InChI | InChI=1S/C22H20FNO2/c23-20-10-6-17(7-11-20)12-18-8-9-19(14-24-26)21(22(18)15-25)13-16-4-2-1-3-5-16/h1-11,25H,12-15H2 |
| InChIKey | KQASXNQIUYHWDB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |