C16H12F3NO — CID 163740452
3-amino-2-[3-(trifluoromethyl)phenyl]-1H-inden-1-ol (PubChem CID 163740452) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-amino-2-[3-(trifluoromethyl)phenyl]-1H-inden-1-ol.
| Compound Name | 3-amino-2-[3-(trifluoromethyl)phenyl]-1H-inden-1-ol |
|---|---|
| PubChem CID | 163740452 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-amino-2-[3-(trifluoromethyl)phenyl]-1H-inden-1-ol |
| SMILES | NC1=C(c2cccc(C(F)(F)F)c2)C(O)c2ccccc21 |
| InChI | InChI=1S/C16H12F3NO/c17-16(18,19)10-5-3-4-9(8-10)13-14(20)11-6-1-2-7-12(11)15(13)21/h1-8,15,21H,20H2 |
| InChIKey | LHGKOTZIDHXIHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|