C21H27F2N3O — CID 57238443
1-[4-[3-(4-fluoro-N-(4-fluorophenyl)anilino)propyl]piperazin-1-yl]ethanol (PubChem CID 57238443) has the molecular formula C21H27F2N3O and a molecular weight of 375.46 g/mol. Its IUPAC name is 1-[4-[3-(4-fluoro-N-(4-fluorophenyl)anilino)propyl]piperazin-1-yl]ethanol.
| Compound Name | 1-[4-[3-(4-fluoro-N-(4-fluorophenyl)anilino)propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 57238443 |
| Molecular Formula | C21H27F2N3O |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 1-[4-[3-(4-fluoro-N-(4-fluorophenyl)anilino)propyl]piperazin-1-yl]ethanol |
| SMILES | CC(O)N1CCN(CCCN(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H27F2N3O/c1-17(27)25-15-13-24(14-16-25)11-2-12-26(20-7-3-18(22)4-8-20)21-9-5-19(23)6-10-21/h3-10,17,27H,2,11-16H2,1H3 |
| InChIKey | AZDHGKADGHXQEK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |